About 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate
9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate (PubChem CID 44816827) has the molecular formula C22H24NO3+
and a molecular weight of 350.44 g/mol. Its IUPAC name is 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate.
Molecular Properties
| Compound Name | 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
| PubChem CID | 44816827 |
| Molecular Formula | C22H24NO3+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
| SMILES | C[N+]12CCC(CC1)[C@@H](OC(=O)OC1c3ccccc3-c3ccccc31)C2 |
| InChI | InChI=1S/C22H24NO3/c1-23-12-10-15(11-13-23)20(14-23)25-22(24)26-21-18-8-4-2-6-16(18)17-7-3-5-9-19(17)21/h2-9,15,20-21H,10-14H2,1H3/q+1/t15?,20-,23?/m0/s1 |
| InChIKey | XJOJRYKMTYPSCO-BOBCHSRXSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate?
The IUPAC name of 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate (CID 44816827) is 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate.
What is the SMILES notation for 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate?
The canonical SMILES for 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate is C[N+]12CCC(CC1)[C@@H](OC(=O)OC1c3ccccc3-c3ccccc31)C2.
What is the InChIKey of 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate?
The InChIKey is XJOJRYKMTYPSCO-BOBCHSRXSA-N. The full InChI is InChI=1S/C22H24NO3/c1-23-12-10-15(11-13-23)20(14-23)25-22(24)26-21-18-8-4-2-6-16(18)17-7-3-5-9-19(17)21/h2-9,15,20-21H,10-14H2,1H3/q+1/t15?,20-,23?/m0/s1.
What are the key properties of 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate?
9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate has a molecular weight of 350.44 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-yl [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate is sourced from PubChem (CID 44816827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).