C27H16F17N5O — CID 44817367
3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)triazol-4-yl]methyl]-2-phenylquinazolin-4-one (PubChem CID 44817367) has the molecular formula C27H16F17N5O and a molecular weight of 749.42 g/mol. Its IUPAC name is 3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)triazol-4-yl]methyl]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)triazol-4-yl]methyl]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 44817367 |
| Molecular Formula | C27H16F17N5O |
| Molecular Weight | 749.42 g/mol |
| Exact Mass | 749.11 |
| IUPAC Name | 3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)triazol-4-yl]methyl]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1Cc1cn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nn1 |
| InChI | InChI=1S/C27H16F17N5O/c28-20(29,21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)26(40,41)27(42,43)44)10-11-48-12-15(46-47-48)13-49-18(14-6-2-1-3-7-14)45-17-9-5-4-8-16(17)19(49)50/h1-9,12H,10-11,13H2 |
| InChIKey | XXLSBMQCIZYUHA-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.42 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|