C24H23F2N3O2 — CID 44817836
2-[10-fluoro-6-[(3-fluoro-4-methoxyphenyl)methyl]-1,2,4,7-tetrahydroindolo[2,3-c][1,7]naphthyridin-3-yl]ethanol (PubChem CID 44817836) has the molecular formula C24H23F2N3O2 and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-[10-fluoro-6-[(3-fluoro-4-methoxyphenyl)methyl]-1,2,4,7-tetrahydroindolo[2,3-c][1,7]naphthyridin-3-yl]ethanol.
| Compound Name | 2-[10-fluoro-6-[(3-fluoro-4-methoxyphenyl)methyl]-1,2,4,7-tetrahydroindolo[2,3-c][1,7]naphthyridin-3-yl]ethanol |
|---|---|
| PubChem CID | 44817836 |
| Molecular Formula | C24H23F2N3O2 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[10-fluoro-6-[(3-fluoro-4-methoxyphenyl)methyl]-1,2,4,7-tetrahydroindolo[2,3-c][1,7]naphthyridin-3-yl]ethanol |
| SMILES | COc1ccc(Cc2nc3c(c4c2[nH]c2ccc(F)cc24)CCN(CCO)C3)cc1F |
| InChI | InChI=1S/C24H23F2N3O2/c1-31-22-5-2-14(10-18(22)26)11-20-24-23(17-12-15(25)3-4-19(17)28-24)16-6-7-29(8-9-30)13-21(16)27-20/h2-5,10,12,28,30H,6-9,11,13H2,1H3 |
| InChIKey | CORWOOSEDSGZHG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |