C16H13F3N6O5 — CID 44818122
(6S)-2-nitro-6-[[2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 44818122) has the molecular formula C16H13F3N6O5 and a molecular weight of 426.31 g/mol. Its IUPAC name is (6S)-2-nitro-6-[[2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-2-nitro-6-[[2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 44818122 |
| Molecular Formula | C16H13F3N6O5 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (6S)-2-nitro-6-[[2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1cnn(-c3ccc(OC(F)(F)F)cc3)n1)C2 |
| InChI | InChI=1S/C16H13F3N6O5/c17-16(18,19)30-12-3-1-11(2-4-12)24-20-5-10(22-24)8-28-13-6-23-7-14(25(26)27)21-15(23)29-9-13/h1-5,7,13H,6,8-9H2/t13-/m0/s1 |
| InChIKey | UPHMXUZJZXFZMB-ZDUSSCGKSA-N |
| XLogP | 2.25 |
| TPSA | 119.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|