C15H12F3N7O5 — CID 44818126
(6S)-2-nitro-6-[[2-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 44818126) has the molecular formula C15H12F3N7O5 and a molecular weight of 427.30 g/mol. Its IUPAC name is (6S)-2-nitro-6-[[2-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-2-nitro-6-[[2-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 44818126 |
| Molecular Formula | C15H12F3N7O5 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | (6S)-2-nitro-6-[[2-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1nnn(-c3ccc(OC(F)(F)F)cc3)n1)C2 |
| InChI | InChI=1S/C15H12F3N7O5/c16-15(17,18)30-10-3-1-9(2-4-10)24-21-12(20-22-24)8-28-11-5-23-6-13(25(26)27)19-14(23)29-7-11/h1-4,6,11H,5,7-8H2/t11-/m0/s1 |
| InChIKey | BMWHXIOSTKATHX-NSHDSACASA-N |
| XLogP | 1.64 |
| TPSA | 132.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|