About (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane
(dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane (PubChem CID 44818884) has the molecular formula C4H12S2
and a molecular weight of 124.27 g/mol. Its IUPAC name is (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane |
| PubChem CID | 44818884 |
| Molecular Formula | C4H12S2 |
| Molecular Weight | 124.27 g/mol |
| Exact Mass | 124.04 |
| IUPAC Name | (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane |
| SMILES | CS(C)=S(C)C |
| InChI | InChI=1S/C4H12S2/c1-5(2)6(3)4/h1-4H3 |
| InChIKey | BQGOZKUQKIGAFK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane?
The IUPAC name of (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane (CID 44818884) is (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane.
What is the SMILES notation for (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane?
The canonical SMILES for (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane is CS(C)=S(C)C.
What is the InChIKey of (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane?
The InChIKey is BQGOZKUQKIGAFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12S2/c1-5(2)6(3)4/h1-4H3.
What are the key properties of (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane?
(dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane has a molecular weight of 124.27 g/mol, XLogP of 0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (dimethyl-λ4-sulfanylidene)-dimethyl-λ4-sulfane is sourced from PubChem (CID 44818884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).