About CID 44819159
CID 44819159 (PubChem CID 44819159) has the molecular formula C16H17BrN2O2
and a molecular weight of 349.23 g/mol.
Molecular Properties
| Compound Name | CID 44819159 |
| PubChem CID | 44819159 |
| Molecular Formula | C16H17BrN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | — |
| SMILES | CN1CCC2(CCCC2=O)C12C(=O)Nc1ccc(Br)cc12 |
| InChI | InChI=1S/C16H17BrN2O2/c1-19-8-7-15(6-2-3-13(15)20)16(19)11-9-10(17)4-5-12(11)18-14(16)21/h4-5,9H,2-3,6-8H2,1H3,(H,18,21) |
| InChIKey | AUWOJXNFZDETSP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 44819159 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 44819159?
The IUPAC name of CID 44819159 (CID 44819159) is not available.
What is the SMILES notation for CID 44819159?
The canonical SMILES for CID 44819159 is CN1CCC2(CCCC2=O)C12C(=O)Nc1ccc(Br)cc12.
What is the InChIKey of CID 44819159?
The InChIKey is AUWOJXNFZDETSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrN2O2/c1-19-8-7-15(6-2-3-13(15)20)16(19)11-9-10(17)4-5-12(11)18-14(16)21/h4-5,9H,2-3,6-8H2,1H3,(H,18,21).
What are the key properties of CID 44819159?
CID 44819159 has a molecular weight of 349.23 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 44819159 is sourced from PubChem (CID 44819159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).