About ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate
ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate (PubChem CID 44819713) has the molecular formula C19H15F2NO4
and a molecular weight of 359.33 g/mol. Its IUPAC name is ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate |
| PubChem CID | 44819713 |
| Molecular Formula | C19H15F2NO4 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(OCc3cccc(F)c3F)c2)on1 |
| InChI | InChI=1S/C19H15F2NO4/c1-2-24-19(23)16-10-17(26-22-16)12-5-3-7-14(9-12)25-11-13-6-4-8-15(20)18(13)21/h3-10H,2,11H2,1H3 |
| InChIKey | YBIZZBNDQPTNRS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate (CID 44819713) is ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate is CCOC(=O)c1cc(-c2cccc(OCc3cccc(F)c3F)c2)on1.
What is the InChIKey of ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate?
The InChIKey is YBIZZBNDQPTNRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2NO4/c1-2-24-19(23)16-10-17(26-22-16)12-5-3-7-14(9-12)25-11-13-6-4-8-15(20)18(13)21/h3-10H,2,11H2,1H3.
What are the key properties of ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate?
ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate has a molecular weight of 359.33 g/mol, XLogP of 4.38, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[3-[(2,3-difluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 44819713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).