C26H27N5O2 — CID 44819875
N-(2-phenoxyphenyl)-7-(4-pyridin-3-yltriazol-1-yl)heptanamide (PubChem CID 44819875) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is N-(2-phenoxyphenyl)-7-(4-pyridin-3-yltriazol-1-yl)heptanamide.
| Compound Name | N-(2-phenoxyphenyl)-7-(4-pyridin-3-yltriazol-1-yl)heptanamide |
|---|---|
| PubChem CID | 44819875 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-(2-phenoxyphenyl)-7-(4-pyridin-3-yltriazol-1-yl)heptanamide |
| SMILES | O=C(CCCCCCn1cc(-c2cccnc2)nn1)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C26H27N5O2/c32-26(28-23-14-7-8-15-25(23)33-22-12-4-3-5-13-22)16-6-1-2-9-18-31-20-24(29-30-31)21-11-10-17-27-19-21/h3-5,7-8,10-15,17,19-20H,1-2,6,9,16,18H2,(H,28,32) |
| InChIKey | BOWRJMOJYLNMFM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|