C12H11NO3 — CID 44820012
(3S,5'S)-5'-methylspiro[1H-indole-3,4'-oxolane]-2,2'-dione (PubChem CID 44820012) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is (3S,5'S)-5'-methylspiro[1H-indole-3,4'-oxolane]-2,2'-dione.
| Compound Name | (3S,5'S)-5'-methylspiro[1H-indole-3,4'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 44820012 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (3S,5'S)-5'-methylspiro[1H-indole-3,4'-oxolane]-2,2'-dione |
| SMILES | C[C@@H]1OC(=O)C[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C12H11NO3/c1-7-12(6-10(14)16-7)8-4-2-3-5-9(8)13-11(12)15/h2-5,7H,6H2,1H3,(H,13,15)/t7-,12+/m0/s1 |
| InChIKey | LQHCRFSEGFPYLD-JVXZTZIISA-N |
| XLogP | 1.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |