C27H30FN5O3S — CID 44820178
1-[5-tert-butyl-3-(2,2-dimethyl-3-oxopiperazine-1-carbonyl)thiophen-2-yl]-3-[3-(2-fluoro-4-pyridinyl)phenyl]urea (PubChem CID 44820178) has the molecular formula C27H30FN5O3S and a molecular weight of 523.63 g/mol. Its IUPAC name is 1-[5-tert-butyl-3-(2,2-dimethyl-3-oxopiperazine-1-carbonyl)thiophen-2-yl]-3-[3-(2-fluoro-4-pyridinyl)phenyl]urea.
| Compound Name | 1-[5-tert-butyl-3-(2,2-dimethyl-3-oxopiperazine-1-carbonyl)thiophen-2-yl]-3-[3-(2-fluoro-4-pyridinyl)phenyl]urea |
|---|---|
| PubChem CID | 44820178 |
| Molecular Formula | C27H30FN5O3S |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 1-[5-tert-butyl-3-(2,2-dimethyl-3-oxopiperazine-1-carbonyl)thiophen-2-yl]-3-[3-(2-fluoro-4-pyridinyl)phenyl]urea |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCNC(=O)C2(C)C)c(NC(=O)Nc2cccc(-c3ccnc(F)c3)c2)s1 |
| InChI | InChI=1S/C27H30FN5O3S/c1-26(2,3)20-15-19(23(34)33-12-11-30-24(35)27(33,4)5)22(37-20)32-25(36)31-18-8-6-7-16(13-18)17-9-10-29-21(28)14-17/h6-10,13-15H,11-12H2,1-5H3,(H,30,35)(H2,31,32,36) |
| InChIKey | DWHZQSXTDOSQEI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|