About (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one
(4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one (PubChem CID 44820524) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one |
| PubChem CID | 44820524 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one |
| SMILES | CCC1=CC(=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H10O3/c1-2-4-3-5(8)7(10)6(4)9/h3,6-7,9-10H,2H2,1H3/t6-,7-/m1/s1 |
| InChIKey | XROXABYYTCTJTE-RNFRBKRXSA-N |
| XLogP | -0.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one?
The IUPAC name of (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one (CID 44820524) is (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one.
What is the SMILES notation for (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one?
The canonical SMILES for (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one is CCC1=CC(=O)[C@@H](O)[C@@H]1O.
What is the InChIKey of (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one?
The InChIKey is XROXABYYTCTJTE-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H10O3/c1-2-4-3-5(8)7(10)6(4)9/h3,6-7,9-10H,2H2,1H3/t6-,7-/m1/s1.
What are the key properties of (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one?
(4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one has a molecular weight of 142.15 g/mol, XLogP of -0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one is sourced from PubChem (CID 44820524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).