About 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate
3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate (PubChem CID 44820679) has the molecular formula C13H17N2O4-
and a molecular weight of 265.29 g/mol. Its IUPAC name is 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate.
Molecular Properties
| Compound Name | 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate |
| PubChem CID | 44820679 |
| Molecular Formula | C13H17N2O4- |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate |
| SMILES | CCC(=O)c1c([O-])n(C2CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H18N2O4/c1-2-9(16)10-11(17)14-13(19)15(12(10)18)8-6-4-3-5-7-8/h8,18H,2-7H2,1H3,(H,14,17,19)/p-1 |
| InChIKey | JEHSPGGXWRVKNQ-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate?
The IUPAC name of 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate (CID 44820679) is 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate.
What is the SMILES notation for 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate?
The canonical SMILES for 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate is CCC(=O)c1c([O-])n(C2CCCCC2)c(=O)[nH]c1=O.
What is the InChIKey of 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate?
The InChIKey is JEHSPGGXWRVKNQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H18N2O4/c1-2-9(16)10-11(17)14-13(19)15(12(10)18)8-6-4-3-5-7-8/h8,18H,2-7H2,1H3,(H,14,17,19)/p-1.
What are the key properties of 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate?
3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate has a molecular weight of 265.29 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-2,6-dioxo-5-propanoylpyrimidin-4-olate is sourced from PubChem (CID 44820679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).