About N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine
N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 44821433) has the molecular formula C16H20F3N5
and a molecular weight of 339.37 g/mol. Its IUPAC name is N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 44821433 |
| Molecular Formula | C16H20F3N5 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1nn(C)cc1-c1cc(C(F)(F)F)nc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C16H20F3N5/c1-10-12(9-24(2)23-10)13-8-14(16(17,18)19)22-15(21-13)20-11-6-4-3-5-7-11/h8-9,11H,3-7H2,1-2H3,(H,20,21,22) |
| InChIKey | KGBRXGQVGDUOSI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine (CID 44821433) is N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine is Cc1nn(C)cc1-c1cc(C(F)(F)F)nc(NC2CCCCC2)n1.
What is the InChIKey of N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is KGBRXGQVGDUOSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F3N5/c1-10-12(9-24(2)23-10)13-8-14(16(17,18)19)22-15(21-13)20-11-6-4-3-5-7-11/h8-9,11H,3-7H2,1-2H3,(H,20,21,22).
What are the key properties of N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine?
N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 339.37 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-(1,3-dimethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 44821433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).