C17H13Cl2N3O3S — CID 44822075
methyl 7-(3,4-dichlorophenyl)-1-ethyl-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate (PubChem CID 44822075) has the molecular formula C17H13Cl2N3O3S and a molecular weight of 410.28 g/mol. Its IUPAC name is methyl 7-(3,4-dichlorophenyl)-1-ethyl-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | methyl 7-(3,4-dichlorophenyl)-1-ethyl-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 44822075 |
| Molecular Formula | C17H13Cl2N3O3S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | methyl 7-(3,4-dichlorophenyl)-1-ethyl-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCn1c(=S)[nH]c(=O)c2c(C(=O)OC)cc(-c3ccc(Cl)c(Cl)c3)nc21 |
| InChI | InChI=1S/C17H13Cl2N3O3S/c1-3-22-14-13(15(23)21-17(22)26)9(16(24)25-2)7-12(20-14)8-4-5-10(18)11(19)6-8/h4-7H,3H2,1-2H3,(H,21,23,26) |
| InChIKey | XEZCUTGPOVGPPC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|