C17H13N3O5S — CID 44823687
7-(1,3-benzodioxol-5-yl)-1-ethyl-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylic acid (PubChem CID 44823687) has the molecular formula C17H13N3O5S and a molecular weight of 371.37 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-1-ethyl-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylic acid.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-1-ethyl-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 44823687 |
| Molecular Formula | C17H13N3O5S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-1-ethyl-4-oxo-2-sulfanylidenepyrido[2,3-d]pyrimidine-5-carboxylic acid |
| SMILES | CCn1c(=S)[nH]c(=O)c2c(C(=O)O)cc(-c3ccc4c(c3)OCO4)nc21 |
| InChI | InChI=1S/C17H13N3O5S/c1-2-20-14-13(15(21)19-17(20)26)9(16(22)23)6-10(18-14)8-3-4-11-12(5-8)25-7-24-11/h3-6H,2,7H2,1H3,(H,22,23)(H,19,21,26) |
| InChIKey | PRQCDYKQHWTGQU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|