About ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate
ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate (PubChem CID 44824405) has the molecular formula C18H16FN3O4
and a molecular weight of 357.34 g/mol. Its IUPAC name is ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate |
| PubChem CID | 44824405 |
| Molecular Formula | C18H16FN3O4 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1cc(C)nc2onc(-c3ccccc3F)c12 |
| InChI | InChI=1S/C18H16FN3O4/c1-3-25-14(23)9-20-17(24)12-8-10(2)21-18-15(12)16(22-26-18)11-6-4-5-7-13(11)19/h4-8H,3,9H2,1-2H3,(H,20,24) |
| InChIKey | JXMOJDNQWNNBPD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate?
The IUPAC name of ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate (CID 44824405) is ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate.
What is the SMILES notation for ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate?
The canonical SMILES for ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate is CCOC(=O)CNC(=O)c1cc(C)nc2onc(-c3ccccc3F)c12.
What is the InChIKey of ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate?
The InChIKey is JXMOJDNQWNNBPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O4/c1-3-25-14(23)9-20-17(24)12-8-10(2)21-18-15(12)16(22-26-18)11-6-4-5-7-13(11)19/h4-8H,3,9H2,1-2H3,(H,20,24).
What are the key properties of ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate?
ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate has a molecular weight of 357.34 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[3-(2-fluorophenyl)-6-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl]amino]acetate is sourced from PubChem (CID 44824405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).