C15H11F4N5O2 — CID 44824639
N-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 44824639) has the molecular formula C15H11F4N5O2 and a molecular weight of 369.28 g/mol. Its IUPAC name is N-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 44824639 |
| Molecular Formula | C15H11F4N5O2 |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)C(F)F)cc1)c1nc2ncccn2n1 |
| InChI | InChI=1S/C15H11F4N5O2/c16-13(17)15(18,19)8-26-10-4-2-9(3-5-10)21-12(25)11-22-14-20-6-1-7-24(14)23-11/h1-7,13H,8H2,(H,21,25) |
| InChIKey | ASYGGKSXIHWBSD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|