C22H23N5O3 — CID 44824897
3-(3-methoxyphenyl)-6-methyl-N-[3-(3-methylpyrazol-1-yl)propyl]-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 44824897) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-6-methyl-N-[3-(3-methylpyrazol-1-yl)propyl]-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 3-(3-methoxyphenyl)-6-methyl-N-[3-(3-methylpyrazol-1-yl)propyl]-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 44824897 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 3-(3-methoxyphenyl)-6-methyl-N-[3-(3-methylpyrazol-1-yl)propyl]-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | COc1cccc(-c2noc3nc(C)cc(C(=O)NCCCn4ccc(C)n4)c23)c1 |
| InChI | InChI=1S/C22H23N5O3/c1-14-8-11-27(25-14)10-5-9-23-21(28)18-12-15(2)24-22-19(18)20(26-30-22)16-6-4-7-17(13-16)29-3/h4,6-8,11-13H,5,9-10H2,1-3H3,(H,23,28) |
| InChIKey | PFFQMPLRVUGWHY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|