C20H19Cl2NO5S — CID 44825372
methyl (2S)-2-[(4Z)-8,10-dichloro-1,1-dioxo-3,6-dihydro-7,1λ6,2-benzoxathiazonin-2-yl]-3-phenylpropanoate (PubChem CID 44825372) has the molecular formula C20H19Cl2NO5S and a molecular weight of 456.35 g/mol. Its IUPAC name is methyl (2S)-2-[(4Z)-8,10-dichloro-1,1-dioxo-3,6-dihydro-7,1λ6,2-benzoxathiazonin-2-yl]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(4Z)-8,10-dichloro-1,1-dioxo-3,6-dihydro-7,1λ6,2-benzoxathiazonin-2-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 44825372 |
| Molecular Formula | C20H19Cl2NO5S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | methyl (2S)-2-[(4Z)-8,10-dichloro-1,1-dioxo-3,6-dihydro-7,1λ6,2-benzoxathiazonin-2-yl]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)N1C/C=C\COc2c(Cl)cc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C20H19Cl2NO5S/c1-27-20(24)17(11-14-7-3-2-4-8-14)23-9-5-6-10-28-19-16(22)12-15(21)13-18(19)29(23,25)26/h2-8,12-13,17H,9-11H2,1H3/b6-5-/t17-/m0/s1 |
| InChIKey | DLFJWWHFMHMITQ-OSJSJHBBSA-N |
| XLogP | 3.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|