About ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate
ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate (PubChem CID 44825385) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate |
| PubChem CID | 44825385 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cn1)[C@H](CCO)NC2 |
| InChI | InChI=1S/C12H16N2O3/c1-2-17-12(16)11-5-8-6-13-10(3-4-15)9(8)7-14-11/h5,7,10,13,15H,2-4,6H2,1H3/t10-/m0/s1 |
| InChIKey | AIADEKXHGUKHQN-JTQLQIEISA-N |
| XLogP | 0.79 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate?
The IUPAC name of ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate (CID 44825385) is ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate.
What is the SMILES notation for ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate?
The canonical SMILES for ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate is CCOC(=O)c1cc2c(cn1)[C@H](CCO)NC2.
What is the InChIKey of ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate?
The InChIKey is AIADEKXHGUKHQN-JTQLQIEISA-N. The full InChI is InChI=1S/C12H16N2O3/c1-2-17-12(16)11-5-8-6-13-10(3-4-15)9(8)7-14-11/h5,7,10,13,15H,2-4,6H2,1H3/t10-/m0/s1.
What are the key properties of ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate?
ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate has a molecular weight of 236.27 g/mol, XLogP of 0.79, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-3-(2-hydroxyethyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-6-carboxylate is sourced from PubChem (CID 44825385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).