C20H31NO4 — CID 44825450
tert-butyl N-phenylmethoxy-N-(5-prop-2-enoxypentyl)carbamate (PubChem CID 44825450) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl N-phenylmethoxy-N-(5-prop-2-enoxypentyl)carbamate.
| Compound Name | tert-butyl N-phenylmethoxy-N-(5-prop-2-enoxypentyl)carbamate |
|---|---|
| PubChem CID | 44825450 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | tert-butyl N-phenylmethoxy-N-(5-prop-2-enoxypentyl)carbamate |
| SMILES | C=CCOCCCCCN(OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO4/c1-5-15-23-16-11-7-10-14-21(19(22)25-20(2,3)4)24-17-18-12-8-6-9-13-18/h5-6,8-9,12-13H,1,7,10-11,14-17H2,2-4H3 |
| InChIKey | JHLJOENKEYOJLF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|