About 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate
1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate (PubChem CID 44825469) has the molecular formula C14H21NO6
and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate |
| PubChem CID | 44825469 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate |
| SMILES | COC(=O)CC(=O)O[C@H]1C=C[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H21NO6/c1-14(2,3)21-13(18)15-9-5-6-10(7-9)20-12(17)8-11(16)19-4/h5-6,9-10H,7-8H2,1-4H3,(H,15,18)/t9-,10+/m1/s1 |
| InChIKey | NQLDLHAGFBEZDI-ZJUUUORDSA-N |
| XLogP | 1.31 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate?
The IUPAC name of 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate (CID 44825469) is 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate.
What is the SMILES notation for 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate?
The canonical SMILES for 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate is COC(=O)CC(=O)O[C@H]1C=C[C@@H](NC(=O)OC(C)(C)C)C1.
What is the InChIKey of 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate?
The InChIKey is NQLDLHAGFBEZDI-ZJUUUORDSA-N. The full InChI is InChI=1S/C14H21NO6/c1-14(2,3)21-13(18)15-9-5-6-10(7-9)20-12(17)8-11(16)19-4/h5-6,9-10H,7-8H2,1-4H3,(H,15,18)/t9-,10+/m1/s1.
What are the key properties of 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate?
1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate has a molecular weight of 299.32 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] propanedioate is sourced from PubChem (CID 44825469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).