C23H25N3O3 — CID 44825507
4-[3-[(3aR,6S,7aS)-5-(2-methoxyacetyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile (PubChem CID 44825507) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-[3-[(3aR,6S,7aS)-5-(2-methoxyacetyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile.
| Compound Name | 4-[3-[(3aR,6S,7aS)-5-(2-methoxyacetyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 44825507 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 4-[3-[(3aR,6S,7aS)-5-(2-methoxyacetyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile |
| SMILES | COCC(=O)N1C[C@H]2CON(C)[C@H]2C[C@H]1c1cccc(-c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-25-21-11-22(26(23(27)15-28-2)13-20(21)14-29-25)19-5-3-4-18(10-19)17-8-6-16(12-24)7-9-17/h3-10,20-22H,11,13-15H2,1-2H3/t20-,21-,22-/m0/s1 |
| InChIKey | HBRZEEZMAVCPRY-FKBYEOEOSA-N |
| XLogP | 3.01 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |