C15H15BrClN3O — CID 44825761
7-bromo-1-(5-chloro-2-pyridinyl)-3,6,6-trimethyl-5,7-dihydroindazol-4-one (PubChem CID 44825761) has the molecular formula C15H15BrClN3O and a molecular weight of 368.66 g/mol. Its IUPAC name is 7-bromo-1-(5-chloro-2-pyridinyl)-3,6,6-trimethyl-5,7-dihydroindazol-4-one.
| Compound Name | 7-bromo-1-(5-chloro-2-pyridinyl)-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 44825761 |
| Molecular Formula | C15H15BrClN3O |
| Molecular Weight | 368.66 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 7-bromo-1-(5-chloro-2-pyridinyl)-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
| SMILES | Cc1nn(-c2ccc(Cl)cn2)c2c1C(=O)CC(C)(C)C2Br |
| InChI | InChI=1S/C15H15BrClN3O/c1-8-12-10(21)6-15(2,3)14(16)13(12)20(19-8)11-5-4-9(17)7-18-11/h4-5,7,14H,6H2,1-3H3 |
| InChIKey | SVOCNFNSBLZTCH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|