About diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate
diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate (PubChem CID 44825770) has the molecular formula C13H19NO5
and a molecular weight of 269.30 g/mol. Its IUPAC name is diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate |
| PubChem CID | 44825770 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N(CC)CCC1=O |
| InChI | InChI=1S/C13H19NO5/c1-4-14-8-7-9(15)10(12(16)18-5-2)11(14)13(17)19-6-3/h4-8H2,1-3H3 |
| InChIKey | QUTAXSLFOLFQHH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate?
The IUPAC name of diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate (CID 44825770) is diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate.
What is the SMILES notation for diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate?
The canonical SMILES for diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate is CCOC(=O)C1=C(C(=O)OCC)N(CC)CCC1=O.
What is the InChIKey of diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate?
The InChIKey is QUTAXSLFOLFQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5/c1-4-14-8-7-9(15)10(12(16)18-5-2)11(14)13(17)19-6-3/h4-8H2,1-3H3.
What are the key properties of diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate?
diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate has a molecular weight of 269.30 g/mol, XLogP of 0.66, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1-ethyl-4-oxo-2,3-dihydropyridine-5,6-dicarboxylate is sourced from PubChem (CID 44825770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).