C21H25NO4 — CID 44825789
benzyl 1-butyl-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 44825789) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is benzyl 1-butyl-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | benzyl 1-butyl-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 44825789 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | benzyl 1-butyl-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCCCN1C(=O)C(C(=O)OCc2ccccc2)CC2=C1CCCC2=O |
| InChI | InChI=1S/C21H25NO4/c1-2-3-12-22-18-10-7-11-19(23)16(18)13-17(20(22)24)21(25)26-14-15-8-5-4-6-9-15/h4-6,8-9,17H,2-3,7,10-14H2,1H3 |
| InChIKey | LFUDNVFZYZHELJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|