C29H29N3O2 — CID 44825816
4-[3-[(3aR,6S,7aS)-1-methyl-5-(3-phenylpropanoyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile (PubChem CID 44825816) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 4-[3-[(3aR,6S,7aS)-1-methyl-5-(3-phenylpropanoyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile.
| Compound Name | 4-[3-[(3aR,6S,7aS)-1-methyl-5-(3-phenylpropanoyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 44825816 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 4-[3-[(3aR,6S,7aS)-1-methyl-5-(3-phenylpropanoyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile |
| SMILES | CN1OC[C@@H]2CN(C(=O)CCc3ccccc3)[C@H](c3cccc(-c4ccc(C#N)cc4)c3)C[C@@H]21 |
| InChI | InChI=1S/C29H29N3O2/c1-31-27-17-28(25-9-5-8-24(16-25)23-13-10-22(18-30)11-14-23)32(19-26(27)20-34-31)29(33)15-12-21-6-3-2-4-7-21/h2-11,13-14,16,26-28H,12,15,17,19-20H2,1H3/t26-,27-,28-/m0/s1 |
| InChIKey | GOJGMXKXVVYBHN-KCHLEUMXSA-N |
| XLogP | 4.99 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |