C27H30N2O — CID 44825828
(3aR,6S,7aS)-5-benzyl-1-methyl-6-[3-(2-methylphenyl)phenyl]-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine (PubChem CID 44825828) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is (3aR,6S,7aS)-5-benzyl-1-methyl-6-[3-(2-methylphenyl)phenyl]-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine.
| Compound Name | (3aR,6S,7aS)-5-benzyl-1-methyl-6-[3-(2-methylphenyl)phenyl]-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 44825828 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | (3aR,6S,7aS)-5-benzyl-1-methyl-6-[3-(2-methylphenyl)phenyl]-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine |
| SMILES | Cc1ccccc1-c1cccc([C@@H]2C[C@H]3[C@H](CON3C)CN2Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H30N2O/c1-20-9-6-7-14-25(20)22-12-8-13-23(15-22)27-16-26-24(19-30-28(26)2)18-29(27)17-21-10-4-3-5-11-21/h3-15,24,26-27H,16-19H2,1-2H3/t24-,26-,27-/m0/s1 |
| InChIKey | CWLJIQZLOVNZND-URORMMCBSA-N |
| XLogP | 5.47 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |