C20H21N3O — CID 44825929
4-[3-[(3aR,6S,7aS)-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile (PubChem CID 44825929) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-[3-[(3aR,6S,7aS)-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile.
| Compound Name | 4-[3-[(3aR,6S,7aS)-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 44825929 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 4-[3-[(3aR,6S,7aS)-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile |
| SMILES | CN1OC[C@@H]2CN[C@H](c3cccc(-c4ccc(C#N)cc4)c3)C[C@@H]21 |
| InChI | InChI=1S/C20H21N3O/c1-23-20-10-19(22-12-18(20)13-24-23)17-4-2-3-16(9-17)15-7-5-14(11-21)6-8-15/h2-9,18-20,22H,10,12-13H2,1H3/t18-,19-,20-/m0/s1 |
| InChIKey | XEKUPEKNDSXKER-UFYCRDLUSA-N |
| XLogP | 3.12 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |