C20H24N2O — CID 44825931
(3aR,6S,7aS)-1,5-dimethyl-6-(3-phenylphenyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine (PubChem CID 44825931) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (3aR,6S,7aS)-1,5-dimethyl-6-(3-phenylphenyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine.
| Compound Name | (3aR,6S,7aS)-1,5-dimethyl-6-(3-phenylphenyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 44825931 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (3aR,6S,7aS)-1,5-dimethyl-6-(3-phenylphenyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine |
| SMILES | CN1C[C@H]2CON(C)[C@H]2C[C@H]1c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H24N2O/c1-21-13-18-14-23-22(2)20(18)12-19(21)17-10-6-9-16(11-17)15-7-4-3-5-8-15/h3-11,18-20H,12-14H2,1-2H3/t18-,19-,20-/m0/s1 |
| InChIKey | TYNUKMPAFBZMDY-UFYCRDLUSA-N |
| XLogP | 3.59 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |