C21H26N2O — CID 44825932
(3aR,6S,7aS)-1,5-dimethyl-6-[3-(2-methylphenyl)phenyl]-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine (PubChem CID 44825932) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (3aR,6S,7aS)-1,5-dimethyl-6-[3-(2-methylphenyl)phenyl]-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine.
| Compound Name | (3aR,6S,7aS)-1,5-dimethyl-6-[3-(2-methylphenyl)phenyl]-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 44825932 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3aR,6S,7aS)-1,5-dimethyl-6-[3-(2-methylphenyl)phenyl]-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridine |
| SMILES | Cc1ccccc1-c1cccc([C@@H]2C[C@H]3[C@H](CON3C)CN2C)c1 |
| InChI | InChI=1S/C21H26N2O/c1-15-7-4-5-10-19(15)16-8-6-9-17(11-16)20-12-21-18(13-22(20)2)14-24-23(21)3/h4-11,18,20-21H,12-14H2,1-3H3/t18-,20-,21-/m0/s1 |
| InChIKey | ALGBRPBVRIIBPO-JBACZVJFSA-N |
| XLogP | 3.90 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |