C27H27N3O — CID 44825936
4-[3-[(3aR,6S,7aS)-5-benzyl-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile (PubChem CID 44825936) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-[3-[(3aR,6S,7aS)-5-benzyl-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile.
| Compound Name | 4-[3-[(3aR,6S,7aS)-5-benzyl-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 44825936 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 4-[3-[(3aR,6S,7aS)-5-benzyl-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-6-yl]phenyl]benzonitrile |
| SMILES | CN1OC[C@@H]2CN(Cc3ccccc3)[C@H](c3cccc(-c4ccc(C#N)cc4)c3)C[C@@H]21 |
| InChI | InChI=1S/C27H27N3O/c1-29-26-15-27(30(18-25(26)19-31-29)17-21-6-3-2-4-7-21)24-9-5-8-23(14-24)22-12-10-20(16-28)11-13-22/h2-14,25-27H,15,17-19H2,1H3/t25-,26-,27-/m0/s1 |
| InChIKey | OZKNHQWFYIARIH-QKDODKLFSA-N |
| XLogP | 5.03 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |