C35H35F3N4O6 — CID 44826041
methyl (1R,2S,7R,8S)-7,10-dibenzyl-5-benzylimino-4-ethyl-9,11-dioxo-4,6,10-triazatricyclo[6.3.0.02,6]undecane-7-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 44826041) has the molecular formula C35H35F3N4O6 and a molecular weight of 664.68 g/mol. Its IUPAC name is methyl (1R,2S,7R,8S)-7,10-dibenzyl-5-benzylimino-4-ethyl-9,11-dioxo-4,6,10-triazatricyclo[6.3.0.02,6]undecane-7-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (1R,2S,7R,8S)-7,10-dibenzyl-5-benzylimino-4-ethyl-9,11-dioxo-4,6,10-triazatricyclo[6.3.0.02,6]undecane-7-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44826041 |
| Molecular Formula | C35H35F3N4O6 |
| Molecular Weight | 664.68 g/mol |
| Exact Mass | 664.25 |
| IUPAC Name | methyl (1R,2S,7R,8S)-7,10-dibenzyl-5-benzylimino-4-ethyl-9,11-dioxo-4,6,10-triazatricyclo[6.3.0.02,6]undecane-7-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCN1C[C@@H]2[C@@H]3C(=O)N(Cc4ccccc4)C(=O)[C@@H]3[C@](Cc3ccccc3)(C(=O)OC)N2/C1=N/Cc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H34N4O4.C2HF3O2/c1-3-35-22-26-27-28(30(39)36(29(27)38)21-25-17-11-6-12-18-25)33(31(40)41-2,19-23-13-7-4-8-14-23)37(26)32(35)34-20-24-15-9-5-10-16-24;3-2(4,5)1(6)7/h4-18,26-28H,3,19-22H2,1-2H3;(H,6,7)/b34-32+;/t26-,27+,28-,33-;/m1./s1 |
| InChIKey | UTKKLLXGDBZTNZ-OKZCQMENSA-N |
| XLogP | 4.15 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.68 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|