About dichloroplatinum(2+);ethylazanium
dichloroplatinum(2+);ethylazanium (PubChem CID 44826257) has the molecular formula C4H14Cl2N2Pt+2
and a molecular weight of 356.15 g/mol. Its IUPAC name is dichloroplatinum(2+);ethylazanium.
Molecular Properties
| Compound Name | dichloroplatinum(2+);ethylazanium |
| PubChem CID | 44826257 |
| Molecular Formula | C4H14Cl2N2Pt+2 |
| Molecular Weight | 356.15 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | dichloroplatinum(2+);ethylazanium |
| SMILES | Cl[Pt+2]Cl.[CH2-]C[NH3+].[CH2-]C[NH3+] |
| InChI | InChI=1S/2C2H6N.2ClH.Pt/c2*1-2-3;;;/h2*1-3H2;2*1H;/q2*-1;;;+4 |
| InChIKey | SJSJJYMXHKBVLK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.15 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichloroplatinum(2+);ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum(2+);ethylazanium?
The IUPAC name of dichloroplatinum(2+);ethylazanium (CID 44826257) is dichloroplatinum(2+);ethylazanium.
What is the SMILES notation for dichloroplatinum(2+);ethylazanium?
The canonical SMILES for dichloroplatinum(2+);ethylazanium is Cl[Pt+2]Cl.[CH2-]C[NH3+].[CH2-]C[NH3+].
What is the InChIKey of dichloroplatinum(2+);ethylazanium?
The InChIKey is SJSJJYMXHKBVLK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H6N.2ClH.Pt/c2*1-2-3;;;/h2*1-3H2;2*1H;/q2*-1;;;+4.
What are the key properties of dichloroplatinum(2+);ethylazanium?
dichloroplatinum(2+);ethylazanium has a molecular weight of 356.15 g/mol, XLogP of -0.50, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum(2+);ethylazanium is sourced from PubChem (CID 44826257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).