C8H11ClN4O8 — CID 44887227
N,N,1-trimethyl-3,5-dinitropyridin-1-ium-4-amine perchlorate (PubChem CID 44887227) has the molecular formula C8H11ClN4O8 and a molecular weight of 326.65 g/mol. Its IUPAC name is N,N,1-trimethyl-3,5-dinitropyridin-1-ium-4-amine perchlorate.
| Compound Name | N,N,1-trimethyl-3,5-dinitropyridin-1-ium-4-amine perchlorate |
|---|---|
| PubChem CID | 44887227 |
| Molecular Formula | C8H11ClN4O8 |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N,N,1-trimethyl-3,5-dinitropyridin-1-ium-4-amine perchlorate |
| SMILES | CN(C)c1c([N+](=O)[O-])c[n+](C)cc1[N+](=O)[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C8H11N4O4.ClHO4/c1-9(2)8-6(11(13)14)4-10(3)5-7(8)12(15)16;2-1(3,4)5/h4-5H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | QPLSIYVYKXHCJI-UHFFFAOYSA-M |
| XLogP | -4.36 |
| TPSA | 185.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|