About 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol
4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol (PubChem CID 44887975) has the molecular formula C21H17N7O7
and a molecular weight of 479.41 g/mol. Its IUPAC name is 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol.
Molecular Properties
| Compound Name | 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol |
| PubChem CID | 44887975 |
| Molecular Formula | C21H17N7O7 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1ccc(-c2cnnn2CCc2ccncc2)cc1 |
| InChI | InChI=1S/C15H14N4.C6H3N3O7/c1-2-4-14(5-3-1)15-12-17-18-19(15)11-8-13-6-9-16-10-7-13;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-7,9-10,12H,8,11H2;1-2,10H |
| InChIKey | GULSMHBLTSWFGE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 193.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol?
The IUPAC name of 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol (CID 44887975) is 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol.
What is the SMILES notation for 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol?
The canonical SMILES for 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol is O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1ccc(-c2cnnn2CCc2ccncc2)cc1.
What is the InChIKey of 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol?
The InChIKey is GULSMHBLTSWFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4.C6H3N3O7/c1-2-4-14(5-3-1)15-12-17-18-19(15)11-8-13-6-9-16-10-7-13;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-7,9-10,12H,8,11H2;1-2,10H.
What are the key properties of 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol?
4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol has a molecular weight of 479.41 g/mol, XLogP of 3.70, 7 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(5-phenyltriazol-1-yl)ethyl]pyridine;2,4,6-trinitrophenol is sourced from PubChem (CID 44887975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).