C23H19F3O4S — CID 44888072
11-phenyl-17-oxoniatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene;trifluoromethanesulfonate (PubChem CID 44888072) has the molecular formula C23H19F3O4S and a molecular weight of 448.46 g/mol. Its IUPAC name is 11-phenyl-17-oxoniatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene;trifluoromethanesulfonate.
| Compound Name | 11-phenyl-17-oxoniatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44888072 |
| Molecular Formula | C23H19F3O4S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 11-phenyl-17-oxoniatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(-c2c3c([o+]c4c2CCc2ccccc2-4)CCC3)cc1 |
| InChI | InChI=1S/C22H19O.CHF3O3S/c1-2-8-16(9-3-1)21-18-11-6-12-20(18)23-22-17-10-5-4-7-15(17)13-14-19(21)22;2-1(3,4)8(5,6)7/h1-5,7-10H,6,11-14H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | KZZQZMSPZAQFRU-UHFFFAOYSA-M |
| XLogP | 5.53 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|