C26H21F3N2O5S — CID 44888173
ethyl 4,6-diphenyl-1-pyridin-2-ylpyridin-1-ium-2-carboxylate;trifluoromethanesulfonate (PubChem CID 44888173) has the molecular formula C26H21F3N2O5S and a molecular weight of 530.52 g/mol. Its IUPAC name is ethyl 4,6-diphenyl-1-pyridin-2-ylpyridin-1-ium-2-carboxylate;trifluoromethanesulfonate.
| Compound Name | ethyl 4,6-diphenyl-1-pyridin-2-ylpyridin-1-ium-2-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44888173 |
| Molecular Formula | C26H21F3N2O5S |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | ethyl 4,6-diphenyl-1-pyridin-2-ylpyridin-1-ium-2-carboxylate;trifluoromethanesulfonate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1-c1ccccn1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C25H21N2O2.CHF3O3S/c1-2-29-25(28)23-18-21(19-11-5-3-6-12-19)17-22(20-13-7-4-8-14-20)27(23)24-15-9-10-16-26-24;2-1(3,4)8(5,6)7/h3-18H,2H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GCIRFTHMFTXQEQ-UHFFFAOYSA-M |
| XLogP | 4.92 |
| TPSA | 100.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|