C25H32Cl2N2O9 — CID 44888197
[4-[hydroxy-phenyl-[4-(trimethylazaniumyl)phenyl]methyl]phenyl]-trimethylazanium diperchlorate (PubChem CID 44888197) has the molecular formula C25H32Cl2N2O9 and a molecular weight of 575.44 g/mol. Its IUPAC name is [4-[hydroxy-phenyl-[4-(trimethylazaniumyl)phenyl]methyl]phenyl]-trimethylazanium diperchlorate.
| Compound Name | [4-[hydroxy-phenyl-[4-(trimethylazaniumyl)phenyl]methyl]phenyl]-trimethylazanium diperchlorate |
|---|---|
| PubChem CID | 44888197 |
| Molecular Formula | C25H32Cl2N2O9 |
| Molecular Weight | 575.44 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | [4-[hydroxy-phenyl-[4-(trimethylazaniumyl)phenyl]methyl]phenyl]-trimethylazanium diperchlorate |
| SMILES | C[N+](C)(C)c1ccc(C(O)(c2ccccc2)c2ccc([N+](C)(C)C)cc2)cc1.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H32N2O.2ClHO4/c1-26(2,3)23-16-12-21(13-17-23)25(28,20-10-8-7-9-11-20)22-14-18-24(19-15-22)27(4,5)6;2*2-1(3,4)5/h7-19,28H,1-6H3;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | AXSGDYPEJDWCCD-UHFFFAOYSA-L |
| XLogP | -5.15 |
| TPSA | 204.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.44 |
| LogP ≤ 5 | -5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|