C29H28ClNO3S — CID 44890531
4-[1-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-2-naphthalen-2-ylethyl]morpholine (PubChem CID 44890531) has the molecular formula C29H28ClNO3S and a molecular weight of 506.07 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-2-naphthalen-2-ylethyl]morpholine.
| Compound Name | 4-[1-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-2-naphthalen-2-ylethyl]morpholine |
|---|---|
| PubChem CID | 44890531 |
| Molecular Formula | C29H28ClNO3S |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 4-[1-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-2-naphthalen-2-ylethyl]morpholine |
| SMILES | Cc1ccc(S(=O)(=O)C(c2ccc3ccccc3c2)C(c2ccc(Cl)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C29H28ClNO3S/c1-21-6-14-27(15-7-21)35(32,33)29(25-9-8-22-4-2-3-5-24(22)20-25)28(31-16-18-34-19-17-31)23-10-12-26(30)13-11-23/h2-15,20,28-29H,16-19H2,1H3 |
| InChIKey | GHQNIAISRBFWBQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |