About 1,6-naphthyridin-5-yl trifluoromethanesulfonate
1,6-naphthyridin-5-yl trifluoromethanesulfonate (PubChem CID 44890805) has the molecular formula C9H5F3N2O3S
and a molecular weight of 278.21 g/mol. Its IUPAC name is 1,6-naphthyridin-5-yl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1,6-naphthyridin-5-yl trifluoromethanesulfonate |
| PubChem CID | 44890805 |
| Molecular Formula | C9H5F3N2O3S |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 1,6-naphthyridin-5-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1nccc2ncccc12)C(F)(F)F |
| InChI | InChI=1S/C9H5F3N2O3S/c10-9(11,12)18(15,16)17-8-6-2-1-4-13-7(6)3-5-14-8/h1-5H |
| InChIKey | JEFYTZPTJXLZSK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1,6-naphthyridin-5-yl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-naphthyridin-5-yl trifluoromethanesulfonate?
The IUPAC name of 1,6-naphthyridin-5-yl trifluoromethanesulfonate (CID 44890805) is 1,6-naphthyridin-5-yl trifluoromethanesulfonate.
What is the SMILES notation for 1,6-naphthyridin-5-yl trifluoromethanesulfonate?
The canonical SMILES for 1,6-naphthyridin-5-yl trifluoromethanesulfonate is O=S(=O)(Oc1nccc2ncccc12)C(F)(F)F.
What is the InChIKey of 1,6-naphthyridin-5-yl trifluoromethanesulfonate?
The InChIKey is JEFYTZPTJXLZSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F3N2O3S/c10-9(11,12)18(15,16)17-8-6-2-1-4-13-7(6)3-5-14-8/h1-5H.
What are the key properties of 1,6-naphthyridin-5-yl trifluoromethanesulfonate?
1,6-naphthyridin-5-yl trifluoromethanesulfonate has a molecular weight of 278.21 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-naphthyridin-5-yl trifluoromethanesulfonate is sourced from PubChem (CID 44890805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).