About pyrrolidine-3-carboxylic acid;hydrochloride
pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 44890816) has the molecular formula C5H10ClNO2
and a molecular weight of 151.59 g/mol. Its IUPAC name is pyrrolidine-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | pyrrolidine-3-carboxylic acid;hydrochloride |
| PubChem CID | 44890816 |
| Molecular Formula | C5H10ClNO2 |
| Molecular Weight | 151.59 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCNC1 |
| InChI | InChI=1S/C5H9NO2.ClH/c7-5(8)4-1-2-6-3-4;/h4,6H,1-3H2,(H,7,8);1H |
| InChIKey | OYCLYMMIZJWYJG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.59 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolidine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-3-carboxylic acid;hydrochloride?
The IUPAC name of pyrrolidine-3-carboxylic acid;hydrochloride (CID 44890816) is pyrrolidine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for pyrrolidine-3-carboxylic acid;hydrochloride?
The canonical SMILES for pyrrolidine-3-carboxylic acid;hydrochloride is Cl.O=C(O)C1CCNC1.
What is the InChIKey of pyrrolidine-3-carboxylic acid;hydrochloride?
The InChIKey is OYCLYMMIZJWYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.ClH/c7-5(8)4-1-2-6-3-4;/h4,6H,1-3H2,(H,7,8);1H.
What are the key properties of pyrrolidine-3-carboxylic acid;hydrochloride?
pyrrolidine-3-carboxylic acid;hydrochloride has a molecular weight of 151.59 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 44890816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).