About 5-bromo-2-chloro-1,3-diethylbenzene
5-bromo-2-chloro-1,3-diethylbenzene (PubChem CID 44891102) has the molecular formula C10H12BrCl
and a molecular weight of 247.56 g/mol. Its IUPAC name is 5-bromo-2-chloro-1,3-diethylbenzene.
Molecular Properties
| Compound Name | 5-bromo-2-chloro-1,3-diethylbenzene |
| PubChem CID | 44891102 |
| Molecular Formula | C10H12BrCl |
| Molecular Weight | 247.56 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 5-bromo-2-chloro-1,3-diethylbenzene |
| SMILES | CCc1cc(Br)cc(CC)c1Cl |
| InChI | InChI=1S/C10H12BrCl/c1-3-7-5-9(11)6-8(4-2)10(7)12/h5-6H,3-4H2,1-2H3 |
| InChIKey | OEFQUZJAISQYEJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-bromo-2-chloro-1,3-diethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-chloro-1,3-diethylbenzene?
The IUPAC name of 5-bromo-2-chloro-1,3-diethylbenzene (CID 44891102) is 5-bromo-2-chloro-1,3-diethylbenzene.
What is the SMILES notation for 5-bromo-2-chloro-1,3-diethylbenzene?
The canonical SMILES for 5-bromo-2-chloro-1,3-diethylbenzene is CCc1cc(Br)cc(CC)c1Cl.
What is the InChIKey of 5-bromo-2-chloro-1,3-diethylbenzene?
The InChIKey is OEFQUZJAISQYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrCl/c1-3-7-5-9(11)6-8(4-2)10(7)12/h5-6H,3-4H2,1-2H3.
What are the key properties of 5-bromo-2-chloro-1,3-diethylbenzene?
5-bromo-2-chloro-1,3-diethylbenzene has a molecular weight of 247.56 g/mol, XLogP of 4.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-chloro-1,3-diethylbenzene is sourced from PubChem (CID 44891102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).