About 5-bromo-1,2-dichloro-3-fluorobenzene
5-bromo-1,2-dichloro-3-fluorobenzene (PubChem CID 44891199) has the molecular formula C6H2BrCl2F
and a molecular weight of 243.89 g/mol. Its IUPAC name is 5-bromo-1,2-dichloro-3-fluorobenzene.
Molecular Properties
| Compound Name | 5-bromo-1,2-dichloro-3-fluorobenzene |
| PubChem CID | 44891199 |
| Molecular Formula | C6H2BrCl2F |
| Molecular Weight | 243.89 g/mol |
| Exact Mass | 241.87 |
| IUPAC Name | 5-bromo-1,2-dichloro-3-fluorobenzene |
| SMILES | Fc1cc(Br)cc(Cl)c1Cl |
| InChI | InChI=1S/C6H2BrCl2F/c7-3-1-4(8)6(9)5(10)2-3/h1-2H |
| InChIKey | NWRZTOGDTNCJHP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1,2-dichloro-3-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,2-dichloro-3-fluorobenzene?
The IUPAC name of 5-bromo-1,2-dichloro-3-fluorobenzene (CID 44891199) is 5-bromo-1,2-dichloro-3-fluorobenzene.
What is the SMILES notation for 5-bromo-1,2-dichloro-3-fluorobenzene?
The canonical SMILES for 5-bromo-1,2-dichloro-3-fluorobenzene is Fc1cc(Br)cc(Cl)c1Cl.
What is the InChIKey of 5-bromo-1,2-dichloro-3-fluorobenzene?
The InChIKey is NWRZTOGDTNCJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrCl2F/c7-3-1-4(8)6(9)5(10)2-3/h1-2H.
What are the key properties of 5-bromo-1,2-dichloro-3-fluorobenzene?
5-bromo-1,2-dichloro-3-fluorobenzene has a molecular weight of 243.89 g/mol, XLogP of 3.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,2-dichloro-3-fluorobenzene is sourced from PubChem (CID 44891199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).