C23H24N4O4S — CID 44901171
N-[2-(2,4-dimethylphenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N'-(1-phenylethyl)oxamide (PubChem CID 44901171) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N'-(1-phenylethyl)oxamide.
| Compound Name | N-[2-(2,4-dimethylphenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N'-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 44901171 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[2-(2,4-dimethylphenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N'-(1-phenylethyl)oxamide |
| SMILES | Cc1ccc(-n2nc3c(c2NC(=O)C(=O)NC(C)c2ccccc2)CS(=O)(=O)C3)c(C)c1 |
| InChI | InChI=1S/C23H24N4O4S/c1-14-9-10-20(15(2)11-14)27-21(18-12-32(30,31)13-19(18)26-27)25-23(29)22(28)24-16(3)17-7-5-4-6-8-17/h4-11,16H,12-13H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | TVGDGHJCSZGBES-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|