C25H23F2N3O2 — CID 44902244
2-(4-benzhydrylpiperazin-1-yl)-N-(2,5-difluorophenyl)-2-oxoacetamide (PubChem CID 44902244) has the molecular formula C25H23F2N3O2 and a molecular weight of 435.47 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-N-(2,5-difluorophenyl)-2-oxoacetamide.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-N-(2,5-difluorophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 44902244 |
| Molecular Formula | C25H23F2N3O2 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-N-(2,5-difluorophenyl)-2-oxoacetamide |
| SMILES | O=C(Nc1cc(F)ccc1F)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H23F2N3O2/c26-20-11-12-21(27)22(17-20)28-24(31)25(32)30-15-13-29(14-16-30)23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-12,17,23H,13-16H2,(H,28,31) |
| InChIKey | BUCUVPNSDOILKB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|