C28H22O8 — CID 44915621
[4-(7-methoxy-1-benzofuran-2-yl)-7-methyl-2-oxochromen-6-yl] 2,6-dimethoxybenzoate (PubChem CID 44915621) has the molecular formula C28H22O8 and a molecular weight of 486.48 g/mol. Its IUPAC name is [4-(7-methoxy-1-benzofuran-2-yl)-7-methyl-2-oxochromen-6-yl] 2,6-dimethoxybenzoate.
| Compound Name | [4-(7-methoxy-1-benzofuran-2-yl)-7-methyl-2-oxochromen-6-yl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 44915621 |
| Molecular Formula | C28H22O8 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [4-(7-methoxy-1-benzofuran-2-yl)-7-methyl-2-oxochromen-6-yl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)Oc1cc2c(-c3cc4cccc(OC)c4o3)cc(=O)oc2cc1C |
| InChI | InChI=1S/C28H22O8/c1-15-11-23-17(13-22(15)36-28(30)26-19(31-2)8-6-9-20(26)32-3)18(14-25(29)34-23)24-12-16-7-5-10-21(33-4)27(16)35-24/h5-14H,1-4H3 |
| InChIKey | BFRMXVNXIFZMPK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 97.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|