C20H22ClFN4O5S2 — CID 44928098
N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide;hydrochloride (PubChem CID 44928098) has the molecular formula C20H22ClFN4O5S2 and a molecular weight of 517.00 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 44928098 |
| Molecular Formula | C20H22ClFN4O5S2 |
| Molecular Weight | 517.00 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide;hydrochloride |
| SMILES | CN(C)CCN(C(=O)CCS(=O)(=O)c1ccc(F)cc1)c1nc2ccc([N+](=O)[O-])cc2s1.Cl |
| InChI | InChI=1S/C20H21FN4O5S2.ClH/c1-23(2)10-11-24(20-22-17-8-5-15(25(27)28)13-18(17)31-20)19(26)9-12-32(29,30)16-6-3-14(21)4-7-16;/h3-8,13H,9-12H2,1-2H3;1H |
| InChIKey | FDEAVIRKRCHLKP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.00 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|