C24H24ClN3O5S2 — CID 44960588
1-(4-chlorophenyl)sulfonyl-N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)piperidine-4-carboxamide (PubChem CID 44960588) has the molecular formula C24H24ClN3O5S2 and a molecular weight of 534.06 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 44960588 |
| Molecular Formula | C24H24ClN3O5S2 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)piperidine-4-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)C2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C24H24ClN3O5S2/c1-4-13-28-21-19(32-2)9-10-20(33-3)22(21)34-24(28)26-23(29)16-11-14-27(15-12-16)35(30,31)18-7-5-17(25)6-8-18/h1,5-10,16H,11-15H2,2-3H3/b26-24- |
| InChIKey | NJFHZHKWFZJINZ-LCUIJRPUSA-N |
| XLogP | 3.53 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|